Acetone standard solution in n-butanol

Beijing Zhongnuo Tai'an Technology Co., Ltd. is mainly engaged in the development and research of new chemical reagents and fine chemical products. Our company has strong technical strength and can develop products according to the different needs of users.
Our company's products mainly consist of laboratory analytical reagents and specialized fine chemical products. This includes environmental analysis reagents, pH buffering agents, various specifications of standard solutions, and some * reagents. This includes ion pair reagents, environmentally friendly analytical reagents, molar powders, pH buffering agents, various specifications of standard solutions, etc. Standard colorimetric solution, turbidity standard solution, formamide standard solution, environmentally friendly standard solution, reagents, 0.2% fuchsin, aminosulfonic acid, sulfur dioxide standard solution, formaldehyde buffer absorption storage solution, naphthylethylenediamine hydrochloride, etc. Food safety rapid testing reagents, food safety rapid testing instruments, water quality rapid testing kits, portable water quality rapid testing instruments, environmental quality testing instruments, etc.
Stable product quality, good business reputation, and excellent after-sales service are Beijing Zhongnuo's commitments to you. Zhongnuo is willing to develop together with you.

Chinese name: Diazo para nitroaniline^[1

English name: 4-NitrodiazoaMinobenzene

Alias:

CAS： 13113-75-2

MDL：

Molecular formula: C12H10N4O2

Molecular weight: 242.2334

SMILES： [O-][N+](=O)c1ccc(cc1)NN=Nc1ccccc1

EINECS: Computational Chemistry Data Editing

1. Reference value for hydrophobic parameter calculation (XlogP): 3.8

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 5

4. Number of rotatable chemical bonds: 3

5. Number of tautomers: 2

6. Topological molecule polarity surface area 82.6

7. Number of heavy atoms: 18

8. Surface charge: 0

9. Complexity: 289

10. Number of isotopic atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1Pharmacopoeia of diazo para nitroaniline test solutionMolecular Structure Data Editing

1. Molar refractive index: 67.57

2. Molar volume (m)³/mol）：188.3

3. Waiting for Zhang Biarong (90.2K): 512.8

4. Surface tension (dyne/cm): 55.0

5. Polarization rate (10)^-24cm³）：26.78^[1